C19H20N2O — CID 4073968
5,7-dimethyl-6-(2-phenylphenoxy)-2,3-dihydro-1H-1,4-diazepine (PubChem CID 4073968) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 5,7-dimethyl-6-(2-phenylphenoxy)-2,3-dihydro-1H-1,4-diazepine.
| Compound Name | 5,7-dimethyl-6-(2-phenylphenoxy)-2,3-dihydro-1H-1,4-diazepine |
|---|---|
| PubChem CID | 4073968 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 5,7-dimethyl-6-(2-phenylphenoxy)-2,3-dihydro-1H-1,4-diazepine |
| SMILES | CC1=NCCNC(C)=C1Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N2O/c1-14-19(15(2)21-13-12-20-14)22-18-11-7-6-10-17(18)16-8-4-3-5-9-16/h3-11,20H,12-13H2,1-2H3 |
| InChIKey | RGRDSEKTJFFUDS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |