C28H23ClN2O5 — CID 4073981
[4-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-(4-chloro-2-methylphenoxy)acetate (PubChem CID 4073981) has the molecular formula C28H23ClN2O5 and a molecular weight of 502.95 g/mol. Its IUPAC name is [4-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-(4-chloro-2-methylphenoxy)acetate.
| Compound Name | [4-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-(4-chloro-2-methylphenoxy)acetate |
|---|---|
| PubChem CID | 4073981 |
| Molecular Formula | C28H23ClN2O5 |
| Molecular Weight | 502.95 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | [4-[[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]methyl]phenyl] 2-(4-chloro-2-methylphenoxy)acetate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)Oc1ccc(C=NNC(=O)COc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C28H23ClN2O5/c1-19-14-23(29)9-13-26(19)35-18-28(33)36-24-10-6-20(7-11-24)16-30-31-27(32)17-34-25-12-8-21-4-2-3-5-22(21)15-25/h2-16H,17-18H2,1H3,(H,31,32) |
| InChIKey | WZIWIMQGEFPDSO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|