About N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide
N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide (PubChem CID 4074167) has the molecular formula C19H21NO4S
and a molecular weight of 359.45 g/mol. Its IUPAC name is N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide |
| PubChem CID | 4074167 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccc3c(c2)CCO3)C2CC2)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-23-17-5-7-18(8-6-17)25(21,22)20(16-3-4-16)13-14-2-9-19-15(12-14)10-11-24-19/h2,5-9,12,16H,3-4,10-11,13H2,1H3 |
| InChIKey | GHSUUSWPYDRBRH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide?
The IUPAC name of N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide (CID 4074167) is N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide.
What is the SMILES notation for N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide?
The canonical SMILES for N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide is COc1ccc(S(=O)(=O)N(Cc2ccc3c(c2)CCO3)C2CC2)cc1.
What is the InChIKey of N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide?
The InChIKey is GHSUUSWPYDRBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4S/c1-23-17-5-7-18(8-6-17)25(21,22)20(16-3-4-16)13-14-2-9-19-15(12-14)10-11-24-19/h2,5-9,12,16H,3-4,10-11,13H2,1H3.
What are the key properties of N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide?
N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide has a molecular weight of 359.45 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methoxybenzenesulfonamide is sourced from PubChem (CID 4074167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).