C21H15NO3 — CID 40742050
(1S,2R,6S,7R)-4-dibenzofuran-3-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 40742050) has the molecular formula C21H15NO3 and a molecular weight of 329.36 g/mol. Its IUPAC name is (1S,2R,6S,7R)-4-dibenzofuran-3-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6S,7R)-4-dibenzofuran-3-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 40742050 |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (1S,2R,6S,7R)-4-dibenzofuran-3-yl-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc3c(c1)oc1ccccc13)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C21H15NO3/c23-20-18-11-5-6-12(9-11)19(18)21(24)22(20)13-7-8-15-14-3-1-2-4-16(14)25-17(15)10-13/h1-8,10-12,18-19H,9H2/t11-,12+,18-,19+ |
| InChIKey | MFOVPQXDIQABKL-ALICBKBLSA-N |
| XLogP | 3.90 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|