About 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one
2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 4074214) has the molecular formula C18H15BrO4
and a molecular weight of 375.22 g/mol. Its IUPAC name is 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 4074214 |
| Molecular Formula | C18H15BrO4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC(c1cc(Br)cc3c1OCOC3)O2 |
| InChI | InChI=1S/C18H15BrO4/c1-10-2-3-16-13(4-10)15(20)7-17(23-16)14-6-12(19)5-11-8-21-9-22-18(11)14/h2-6,17H,7-9H2,1H3 |
| InChIKey | TYPFLCLCVAGFOU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one (CID 4074214) is 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one is Cc1ccc2c(c1)C(=O)CC(c1cc(Br)cc3c1OCOC3)O2.
What is the InChIKey of 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one?
The InChIKey is TYPFLCLCVAGFOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15BrO4/c1-10-2-3-16-13(4-10)15(20)7-17(23-16)14-6-12(19)5-11-8-21-9-22-18(11)14/h2-6,17H,7-9H2,1H3.
What are the key properties of 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one?
2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one has a molecular weight of 375.22 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-4H-1,3-benzodioxin-8-yl)-6-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 4074214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).