C14H22N2O4S — CID 40742236
4-methoxy-3-(methylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide (PubChem CID 40742236) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-methoxy-3-(methylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide.
| Compound Name | 4-methoxy-3-(methylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 40742236 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-methoxy-3-(methylsulfamoyl)-N-[(2R)-pentan-2-yl]benzamide |
| SMILES | CCC[C@@H](C)NC(=O)c1ccc(OC)c(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C14H22N2O4S/c1-5-6-10(2)16-14(17)11-7-8-12(20-4)13(9-11)21(18,19)15-3/h7-10,15H,5-6H2,1-4H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | YNQOEBJTKDEOEZ-SNVBAGLBSA-N |
| XLogP | 1.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |