About 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile
4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile (PubChem CID 40756788) has the molecular formula C10H9N5OS
and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile |
| PubChem CID | 40756788 |
| Molecular Formula | C10H9N5OS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile |
| SMILES | Cc1cc(CSc2ncc(C#N)c(N)n2)on1 |
| InChI | InChI=1S/C10H9N5OS/c1-6-2-8(16-15-6)5-17-10-13-4-7(3-11)9(12)14-10/h2,4H,5H2,1H3,(H2,12,13,14) |
| InChIKey | RGIBNHADUHPLQK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile?
The IUPAC name of 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile (CID 40756788) is 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile?
The canonical SMILES for 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile is Cc1cc(CSc2ncc(C#N)c(N)n2)on1.
What is the InChIKey of 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile?
The InChIKey is RGIBNHADUHPLQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5OS/c1-6-2-8(16-15-6)5-17-10-13-4-7(3-11)9(12)14-10/h2,4H,5H2,1H3,(H2,12,13,14).
What are the key properties of 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile?
4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile has a molecular weight of 247.28 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[(3-methyl-1,2-oxazol-5-yl)methylsulfanyl]pyrimidine-5-carbonitrile is sourced from PubChem (CID 40756788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).