C15H17F3N2O2 — CID 4076701
4,6-dimethyl-3-(4,4,4-trifluoro-3-pyrrolidin-1-ylbut-2-enoyl)-1H-pyridin-2-one (PubChem CID 4076701) has the molecular formula C15H17F3N2O2 and a molecular weight of 314.31 g/mol. Its IUPAC name is 4,6-dimethyl-3-(4,4,4-trifluoro-3-pyrrolidin-1-ylbut-2-enoyl)-1H-pyridin-2-one.
| Compound Name | 4,6-dimethyl-3-(4,4,4-trifluoro-3-pyrrolidin-1-ylbut-2-enoyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 4076701 |
| Molecular Formula | C15H17F3N2O2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 4,6-dimethyl-3-(4,4,4-trifluoro-3-pyrrolidin-1-ylbut-2-enoyl)-1H-pyridin-2-one |
| SMILES | Cc1cc(C)c(C(=O)C=C(N2CCCC2)C(F)(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17F3N2O2/c1-9-7-10(2)19-14(22)13(9)11(21)8-12(15(16,17)18)20-5-3-4-6-20/h7-8H,3-6H2,1-2H3,(H,19,22) |
| InChIKey | UNNOZQPRCQIGOE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|