C18H18F3NO2 — CID 40769007
(2R)-2-(2,4-dimethylphenoxy)-N-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 40769007) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is (2R)-2-(2,4-dimethylphenoxy)-N-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-(2,4-dimethylphenoxy)-N-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 40769007 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2R)-2-(2,4-dimethylphenoxy)-N-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1ccc(O[C@H](C)C(=O)Nc2ccc(C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C18H18F3NO2/c1-11-4-9-16(12(2)10-11)24-13(3)17(23)22-15-7-5-14(6-8-15)18(19,20)21/h4-10,13H,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | KQIOKYFAZRKHBG-CYBMUJFWSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |