C16H14BrClN2O3 — CID 40771324
2-[[(2R)-2-(2-bromo-4-chlorophenoxy)propanoyl]amino]benzamide (PubChem CID 40771324) has the molecular formula C16H14BrClN2O3 and a molecular weight of 397.66 g/mol. Its IUPAC name is 2-[[(2R)-2-(2-bromo-4-chlorophenoxy)propanoyl]amino]benzamide.
| Compound Name | 2-[[(2R)-2-(2-bromo-4-chlorophenoxy)propanoyl]amino]benzamide |
|---|---|
| PubChem CID | 40771324 |
| Molecular Formula | C16H14BrClN2O3 |
| Molecular Weight | 397.66 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-[[(2R)-2-(2-bromo-4-chlorophenoxy)propanoyl]amino]benzamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Br)C(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C16H14BrClN2O3/c1-9(23-14-7-6-10(18)8-12(14)17)16(22)20-13-5-3-2-4-11(13)15(19)21/h2-9H,1H3,(H2,19,21)(H,20,22)/t9-/m1/s1 |
| InChIKey | VOYJVPTYNMLEMY-SECBINFHSA-N |
| XLogP | 3.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |