C20H25NO3 — CID 40771491
(2R)-2-(2,5-dimethylphenoxy)-N-(4-propan-2-yloxyphenyl)propanamide (PubChem CID 40771491) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethylphenoxy)-N-(4-propan-2-yloxyphenyl)propanamide.
| Compound Name | (2R)-2-(2,5-dimethylphenoxy)-N-(4-propan-2-yloxyphenyl)propanamide |
|---|---|
| PubChem CID | 40771491 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2R)-2-(2,5-dimethylphenoxy)-N-(4-propan-2-yloxyphenyl)propanamide |
| SMILES | Cc1ccc(C)c(O[C@H](C)C(=O)Nc2ccc(OC(C)C)cc2)c1 |
| InChI | InChI=1S/C20H25NO3/c1-13(2)23-18-10-8-17(9-11-18)21-20(22)16(5)24-19-12-14(3)6-7-15(19)4/h6-13,16H,1-5H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | NUGQIXLFGSXSPK-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |