C23H22N4O3 — CID 40771922
(5R)-1,3,7-trimethyl-2,4-dioxo-N,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 40771922) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is (5R)-1,3,7-trimethyl-2,4-dioxo-N,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | (5R)-1,3,7-trimethyl-2,4-dioxo-N,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 40771922 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (5R)-1,3,7-trimethyl-2,4-dioxo-N,5-diphenyl-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)[C@@H](c2ccccc2)c2c(n(C)c(=O)n(C)c2=O)N1 |
| InChI | InChI=1S/C23H22N4O3/c1-14-17(21(28)25-16-12-8-5-9-13-16)18(15-10-6-4-7-11-15)19-20(24-14)26(2)23(30)27(3)22(19)29/h4-13,18,24H,1-3H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | SVENLSMCHGLOEL-GOSISDBHSA-N |
| XLogP | 2.55 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |