C27H28N4O3 — CID 40774758
N-(4-ethylphenyl)-2-[(4S)-1-(4-methylphenyl)-2,5-dioxo-3-(2-pyridin-4-ylethyl)imidazolidin-4-yl]acetamide (PubChem CID 40774758) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-(4-ethylphenyl)-2-[(4S)-1-(4-methylphenyl)-2,5-dioxo-3-(2-pyridin-4-ylethyl)imidazolidin-4-yl]acetamide.
| Compound Name | N-(4-ethylphenyl)-2-[(4S)-1-(4-methylphenyl)-2,5-dioxo-3-(2-pyridin-4-ylethyl)imidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 40774758 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-(4-ethylphenyl)-2-[(4S)-1-(4-methylphenyl)-2,5-dioxo-3-(2-pyridin-4-ylethyl)imidazolidin-4-yl]acetamide |
| SMILES | CCc1ccc(NC(=O)C[C@H]2C(=O)N(c3ccc(C)cc3)C(=O)N2CCc2ccncc2)cc1 |
| InChI | InChI=1S/C27H28N4O3/c1-3-20-6-8-22(9-7-20)29-25(32)18-24-26(33)31(23-10-4-19(2)5-11-23)27(34)30(24)17-14-21-12-15-28-16-13-21/h4-13,15-16,24H,3,14,17-18H2,1-2H3,(H,29,32)/t24-/m0/s1 |
| InChIKey | INQXELNNXDVXKB-DEOSSOPVSA-N |
| XLogP | 4.36 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|