C14H26O9Si2 — CID 4077744
2-[[[2,2-dicarboxypropyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-2-methylpropanedioic acid (PubChem CID 4077744) has the molecular formula C14H26O9Si2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 2-[[[2,2-dicarboxypropyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-2-methylpropanedioic acid.
| Compound Name | 2-[[[2,2-dicarboxypropyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 4077744 |
| Molecular Formula | C14H26O9Si2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[[[2,2-dicarboxypropyl(dimethyl)silyl]oxy-dimethylsilyl]methyl]-2-methylpropanedioic acid |
| SMILES | CC(C[Si](C)(C)O[Si](C)(C)CC(C)(C(=O)O)C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26O9Si2/c1-13(9(15)16,10(17)18)7-24(3,4)23-25(5,6)8-14(2,11(19)20)12(21)22/h7-8H2,1-6H3,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | FHQOAKUFXXWBTI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|