C20H23ClN4 — CID 40777567
3-[4-[(1S,4S)-4-[(3-chlorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]propanenitrile (PubChem CID 40777567) has the molecular formula C20H23ClN4 and a molecular weight of 354.89 g/mol. Its IUPAC name is 3-[4-[(1S,4S)-4-[(3-chlorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[(1S,4S)-4-[(3-chlorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 40777567 |
| Molecular Formula | C20H23ClN4 |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 3-[4-[(1S,4S)-4-[(3-chlorophenyl)methylamino]cyclopent-2-en-1-yl]-3,5-dimethylpyrazol-1-yl]propanenitrile |
| SMILES | Cc1nn(CCC#N)c(C)c1[C@@H]1C=C[C@@H](NCc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H23ClN4/c1-14-20(15(2)25(24-14)10-4-9-22)17-7-8-19(12-17)23-13-16-5-3-6-18(21)11-16/h3,5-8,11,17,19,23H,4,10,12-13H2,1-2H3/t17-,19-/m1/s1 |
| InChIKey | MNAPDYFTWGRXFB-IEBWSBKVSA-N |
| XLogP | 4.27 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|