C26H29F3N4 — CID 40777668
4-[[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline (PubChem CID 40777668) has the molecular formula C26H29F3N4 and a molecular weight of 454.54 g/mol. Its IUPAC name is 4-[[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 40777668 |
| Molecular Formula | C26H29F3N4 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 4-[[[(1S,4S)-4-[3,5-dimethyl-1-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]cyclopent-2-en-1-yl]amino]methyl]-N,N-dimethylaniline |
| SMILES | Cc1nn(-c2ccc(C(F)(F)F)cc2)c(C)c1[C@@H]1C=C[C@@H](NCc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C26H29F3N4/c1-17-25(18(2)33(31-17)24-13-8-21(9-14-24)26(27,28)29)20-7-10-22(15-20)30-16-19-5-11-23(12-6-19)32(3)4/h5-14,20,22,30H,15-16H2,1-4H3/t20-,22-/m1/s1 |
| InChIKey | PHCHWQRLXLGKBX-IFMALSPDSA-N |
| XLogP | 5.78 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|