About 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol
3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol (PubChem CID 4077767) has the molecular formula C17H17N5O
and a molecular weight of 307.36 g/mol. Its IUPAC name is 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol |
| PubChem CID | 4077767 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol |
| SMILES | OCCCNc1cc(-c2ccccn2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C17H17N5O/c23-11-5-10-20-16-12-15(13-6-1-3-8-18-13)21-17(22-16)14-7-2-4-9-19-14/h1-4,6-9,12,23H,5,10-11H2,(H,20,21,22) |
| InChIKey | HKYXJDAEQGHDRJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol?
The IUPAC name of 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol (CID 4077767) is 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol is OCCCNc1cc(-c2ccccn2)nc(-c2ccccn2)n1.
What is the InChIKey of 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol?
The InChIKey is HKYXJDAEQGHDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N5O/c23-11-5-10-20-16-12-15(13-6-1-3-8-18-13)21-17(22-16)14-7-2-4-9-19-14/h1-4,6-9,12,23H,5,10-11H2,(H,20,21,22).
What are the key properties of 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol?
3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol has a molecular weight of 307.36 g/mol, XLogP of 2.39, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dipyridin-2-ylpyrimidin-4-yl)amino]propan-1-ol is sourced from PubChem (CID 4077767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).