C12H22N2O6 — CID 40777952
2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 40777952) has the molecular formula C12H22N2O6 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 40777952 |
| Molecular Formula | C12H22N2O6 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-5-(acetamidomethyl)-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1O[C@H](CNC(C)=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H22N2O6/c1-7(15)14-6-9-12(18)11(17)8(20-9)5-10(16)13-3-4-19-2/h8-9,11-12,17-18H,3-6H2,1-2H3,(H,13,16)(H,14,15)/t8-,9+,11-,12+/m0/s1 |
| InChIKey | PBUBKXZEPAVKMZ-BSJXLVFVSA-N |
| XLogP | -2.24 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|