C17H31N3O6 — CID 40777954
2-[(2S,3R,4S,5R)-5-[(cyclohexylcarbamoylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 40777954) has the molecular formula C17H31N3O6 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-[(2S,3R,4S,5R)-5-[(cyclohexylcarbamoylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2S,3R,4S,5R)-5-[(cyclohexylcarbamoylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 40777954 |
| Molecular Formula | C17H31N3O6 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 2-[(2S,3R,4S,5R)-5-[(cyclohexylcarbamoylamino)methyl]-3,4-dihydroxyoxolan-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1O[C@H](CNC(=O)NC2CCCCC2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H31N3O6/c1-25-8-7-18-14(21)9-12-15(22)16(23)13(26-12)10-19-17(24)20-11-5-3-2-4-6-11/h11-13,15-16,22-23H,2-10H2,1H3,(H,18,21)(H2,19,20,24)/t12-,13+,15-,16+/m0/s1 |
| InChIKey | JSDCNHJGWDCTBB-LQKXBSAESA-N |
| XLogP | -0.74 |
| TPSA | 129.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|