C20H22N2O10 — CID 40778145
(2S,3S)-2,3-bis[2-(2-nitrophenoxy)ethoxy]-1,4-dioxane (PubChem CID 40778145) has the molecular formula C20H22N2O10 and a molecular weight of 450.40 g/mol. Its IUPAC name is (2S,3S)-2,3-bis[2-(2-nitrophenoxy)ethoxy]-1,4-dioxane.
| Compound Name | (2S,3S)-2,3-bis[2-(2-nitrophenoxy)ethoxy]-1,4-dioxane |
|---|---|
| PubChem CID | 40778145 |
| Molecular Formula | C20H22N2O10 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (2S,3S)-2,3-bis[2-(2-nitrophenoxy)ethoxy]-1,4-dioxane |
| SMILES | O=[N+]([O-])c1ccccc1OCCO[C@H]1OCCO[C@@H]1OCCOc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N2O10/c23-21(24)15-5-1-3-7-17(15)27-9-11-29-19-20(32-14-13-31-19)30-12-10-28-18-8-4-2-6-16(18)22(25)26/h1-8,19-20H,9-14H2/t19-,20-/m0/s1 |
| InChIKey | VRGLTKHPXYPDRK-PMACEKPBSA-N |
| XLogP | 2.69 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|