C10H8Cl3N5OS — CID 4077853
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 4077853) has the molecular formula C10H8Cl3N5OS and a molecular weight of 352.63 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 4077853 |
| Molecular Formula | C10H8Cl3N5OS |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | Nc1nc(SCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C10H8Cl3N5OS/c11-4-1-6(13)7(2-5(4)12)15-8(19)3-20-10-16-9(14)17-18-10/h1-2H,3H2,(H,15,19)(H3,14,16,17,18) |
| InChIKey | FVKIUYYQAJIOAR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|