C26H31N3 — CID 40780373
(1S,4S)-N-benzyl-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-amine (PubChem CID 40780373) has the molecular formula C26H31N3 and a molecular weight of 385.56 g/mol. Its IUPAC name is (1S,4S)-N-benzyl-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-N-benzyl-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 40780373 |
| Molecular Formula | C26H31N3 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.25 |
| IUPAC Name | (1S,4S)-N-benzyl-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccc(C(C)C)cc2)c(C)c1[C@@H]1C=C[C@@H](NCc2ccccc2)C1 |
| InChI | InChI=1S/C26H31N3/c1-18(2)22-11-14-25(15-12-22)29-20(4)26(19(3)28-29)23-10-13-24(16-23)27-17-21-8-6-5-7-9-21/h5-15,18,23-24,27H,16-17H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | QQSLZBHBAAODFJ-DNQXCXABSA-N |
| XLogP | 5.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|