C22H30N4O — CID 40780378
1-[(1S,4S)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]-3-ethylurea (PubChem CID 40780378) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-[(1S,4S)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]-3-ethylurea.
| Compound Name | 1-[(1S,4S)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]-3-ethylurea |
|---|---|
| PubChem CID | 40780378 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 1-[(1S,4S)-4-[3,5-dimethyl-1-(4-propan-2-ylphenyl)pyrazol-4-yl]cyclopent-2-en-1-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@@H]1C=C[C@@H](c2c(C)nn(-c3ccc(C(C)C)cc3)c2C)C1 |
| InChI | InChI=1S/C22H30N4O/c1-6-23-22(27)24-19-10-7-18(13-19)21-15(4)25-26(16(21)5)20-11-8-17(9-12-20)14(2)3/h7-12,14,18-19H,6,13H2,1-5H3,(H2,23,24,27)/t18-,19-/m1/s1 |
| InChIKey | QKXZFPFCHAMCDS-RTBURBONSA-N |
| XLogP | 4.34 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|