C18H20N4OS — CID 40780397
N-[(1S,4S)-4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-carboxamide (PubChem CID 40780397) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is N-[(1S,4S)-4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-carboxamide.
| Compound Name | N-[(1S,4S)-4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 40780397 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[(1S,4S)-4-[1-(2-cyanoethyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]thiophene-2-carboxamide |
| SMILES | Cc1nn(CCC#N)c(C)c1[C@@H]1C=C[C@@H](NC(=O)c2cccs2)C1 |
| InChI | InChI=1S/C18H20N4OS/c1-12-17(13(2)22(21-12)9-4-8-19)14-6-7-15(11-14)20-18(23)16-5-3-10-24-16/h3,5-7,10,14-15H,4,9,11H2,1-2H3,(H,20,23)/t14-,15-/m1/s1 |
| InChIKey | MNPYJCNMJYIOEZ-HUUCEWRRSA-N |
| XLogP | 3.32 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|