C24H26FN3O — CID 40780411
(1S,4S)-N-[(4-fluorophenyl)methyl]-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine (PubChem CID 40780411) has the molecular formula C24H26FN3O and a molecular weight of 391.49 g/mol. Its IUPAC name is (1S,4S)-N-[(4-fluorophenyl)methyl]-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-N-[(4-fluorophenyl)methyl]-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 40780411 |
| Molecular Formula | C24H26FN3O |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (1S,4S)-N-[(4-fluorophenyl)methyl]-4-[1-(4-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-amine |
| SMILES | COc1ccc(-n2nc(C)c([C@@H]3C=C[C@@H](NCc4ccc(F)cc4)C3)c2C)cc1 |
| InChI | InChI=1S/C24H26FN3O/c1-16-24(17(2)28(27-16)22-10-12-23(29-3)13-11-22)19-6-9-21(14-19)26-15-18-4-7-20(25)8-5-18/h4-13,19,21,26H,14-15H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | JPIHKKVXRDWSMA-TZIWHRDSSA-N |
| XLogP | 4.84 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|