C23H23FN4O2 — CID 40780420
(1S,4S)-4-[3,5-dimethyl-1-(2-nitrophenyl)pyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 40780420) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is (1S,4S)-4-[3,5-dimethyl-1-(2-nitrophenyl)pyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-4-[3,5-dimethyl-1-(2-nitrophenyl)pyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 40780420 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (1S,4S)-4-[3,5-dimethyl-1-(2-nitrophenyl)pyrazol-4-yl]-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccccc2[N+](=O)[O-])c(C)c1[C@@H]1C=C[C@@H](NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H23FN4O2/c1-15-23(16(2)27(26-15)21-5-3-4-6-22(21)28(29)30)18-9-12-20(13-18)25-14-17-7-10-19(24)11-8-17/h3-12,18,20,25H,13-14H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | UEGDPOMTSAFDGB-UYAOXDASSA-N |
| XLogP | 4.74 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|