C23H24FN3 — CID 40780440
(1S,4S)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine (PubChem CID 40780440) has the molecular formula C23H24FN3 and a molecular weight of 361.46 g/mol. Its IUPAC name is (1S,4S)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine.
| Compound Name | (1S,4S)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 40780440 |
| Molecular Formula | C23H24FN3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | (1S,4S)-4-(3,5-dimethyl-1-phenylpyrazol-4-yl)-N-[(4-fluorophenyl)methyl]cyclopent-2-en-1-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[C@@H]1C=C[C@@H](NCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C23H24FN3/c1-16-23(17(2)27(26-16)22-6-4-3-5-7-22)19-10-13-21(14-19)25-15-18-8-11-20(24)12-9-18/h3-13,19,21,25H,14-15H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | REQSPCSALKVXQA-TZIWHRDSSA-N |
| XLogP | 4.83 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|