C21H20FN3O2 — CID 40780446
N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]furan-2-carboxamide (PubChem CID 40780446) has the molecular formula C21H20FN3O2 and a molecular weight of 365.41 g/mol. Its IUPAC name is N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]furan-2-carboxamide.
| Compound Name | N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 40780446 |
| Molecular Formula | C21H20FN3O2 |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[(1S,4S)-4-[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]cyclopent-2-en-1-yl]furan-2-carboxamide |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1[C@@H]1C=C[C@@H](NC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C21H20FN3O2/c1-13-20(14(2)25(24-13)18-9-6-16(22)7-10-18)15-5-8-17(12-15)23-21(26)19-4-3-11-27-19/h3-11,15,17H,12H2,1-2H3,(H,23,26)/t15-,17-/m1/s1 |
| InChIKey | FLASPQXIMAPXIV-NVXWUHKLSA-N |
| XLogP | 4.06 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|