C17H22FN3O4S — CID 40780686
(3aR,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-methoxyethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780686) has the molecular formula C17H22FN3O4S and a molecular weight of 383.45 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-methoxyethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-methoxyethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780686 |
| Molecular Formula | C17H22FN3O4S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-3-(4-fluorophenyl)-6,7-dihydroxy-N-(2-methoxyethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccc(F)cc3)[C@@H]21 |
| InChI | InChI=1S/C17H22FN3O4S/c1-25-7-6-19-16(24)11-8-12(22)15(23)13-14(11)21(17(26)20-13)10-4-2-9(18)3-5-10/h2-5,11-15,22-23H,6-8H2,1H3,(H,19,24)(H,20,26)/t11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | PPEIMJUQKMODCC-RYPNDVFKSA-N |
| XLogP | -0.24 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|