C22H22F3N3O4S — CID 40780851
(3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 40780851) has the molecular formula C22H22F3N3O4S and a molecular weight of 481.50 g/mol. Its IUPAC name is (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 40780851 |
| Molecular Formula | C22H22F3N3O4S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (3aS,4R,5R,7R,7aR)-N-benzyl-4,5-dihydroxy-2-[4-(trifluoromethoxy)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(OC(F)(F)F)cc3)S[C@@H]21 |
| InChI | InChI=1S/C22H22F3N3O4S/c23-22(24,25)32-14-8-6-13(7-9-14)27-21-28-17-18(30)16(29)10-15(19(17)33-21)20(31)26-11-12-4-2-1-3-5-12/h1-9,15-19,29-30H,10-11H2,(H,26,31)(H,27,28)/t15-,16+,17-,18-,19+/m0/s1 |
| InChIKey | IFIOWBUNZJWXMY-XCDZQEORSA-N |
| XLogP | 2.90 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |