C19H22F3N3O4S — CID 40780864
[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone (PubChem CID 40780864) has the molecular formula C19H22F3N3O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is [(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 40780864 |
| Molecular Formula | C19H22F3N3O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | [(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-[3-(trifluoromethyl)anilino]-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3cccc(C(F)(F)F)c3)S[C@@H]21)N1CCOCC1 |
| InChI | InChI=1S/C19H22F3N3O4S/c20-19(21,22)10-2-1-3-11(8-10)23-18-24-14-15(27)13(26)9-12(16(14)30-18)17(28)25-4-6-29-7-5-25/h1-3,8,12-16,26-27H,4-7,9H2,(H,23,24)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | SOZXAFBBXYMNSJ-XFIYOXNOSA-N |
| XLogP | 1.56 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |