C21H28N4O4S — CID 40780880
1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide (PubChem CID 40780880) has the molecular formula C21H28N4O4S and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 40780880 |
| Molecular Formula | C21H28N4O4S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 1-[(3aS,4R,5R,7R,7aR)-4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC2=N[C@H]3[C@@H](O)[C@H](O)C[C@H](C(=O)N4CCC(C(N)=O)CC4)[C@H]3S2)cc1 |
| InChI | InChI=1S/C21H28N4O4S/c1-11-2-4-13(5-3-11)23-21-24-16-17(27)15(26)10-14(18(16)30-21)20(29)25-8-6-12(7-9-25)19(22)28/h2-5,12,14-18,26-27H,6-10H2,1H3,(H2,22,28)(H,23,24)/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | KPXMJPHZAYXNHK-FLXSYLCISA-N |
| XLogP | 0.71 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |