C17H20N2O5S3 — CID 40780920
ethyl (3R)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonylcarbonylpiperidine-3-carboxylate (PubChem CID 40780920) has the molecular formula C17H20N2O5S3 and a molecular weight of 428.56 g/mol. Its IUPAC name is ethyl (3R)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonylcarbonylpiperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonylcarbonylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 40780920 |
| Molecular Formula | C17H20N2O5S3 |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | ethyl (3R)-1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]sulfonylcarbonylpiperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)S(=O)(=O)c2ccc(-c3csc(C)n3)s2)C1 |
| InChI | InChI=1S/C17H20N2O5S3/c1-3-24-16(20)12-5-4-8-19(9-12)17(21)27(22,23)15-7-6-14(26-15)13-10-25-11(2)18-13/h6-7,10,12H,3-5,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | RFMJWJNPMRMASO-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|