C11H21NO2S — CID 4078136
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]ethanesulfonamide (PubChem CID 4078136) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]ethanesulfonamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 4078136 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(C)C1CC2CCC1C2 |
| InChI | InChI=1S/C11H21NO2S/c1-3-15(13,14)12-8(2)11-7-9-4-5-10(11)6-9/h8-12H,3-7H2,1-2H3 |
| InChIKey | IQSPEGFQINOOAC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |