C18H22ClN3O4S — CID 40781675
[(3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone (PubChem CID 40781675) has the molecular formula C18H22ClN3O4S and a molecular weight of 411.91 g/mol. Its IUPAC name is [(3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 40781675 |
| Molecular Formula | C18H22ClN3O4S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | [(3aS,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-morpholin-4-ylmethanone |
| SMILES | O=C([C@H]1C[C@@H](O)[C@H](O)[C@@H]2N=C(Nc3ccc(Cl)cc3)S[C@@H]21)N1CCOCC1 |
| InChI | InChI=1S/C18H22ClN3O4S/c19-10-1-3-11(4-2-10)20-18-21-14-15(24)13(23)9-12(16(14)27-18)17(25)22-5-7-26-8-6-22/h1-4,12-16,23-24H,5-9H2,(H,20,21)/t12-,13+,14-,15-,16+/m0/s1 |
| InChIKey | JYJOXQACVRXQGJ-XFIYOXNOSA-N |
| XLogP | 1.19 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |