C21H25N3O4 — CID 40781881
N-(3-ethoxypropyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 40781881) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-ethoxypropyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 40781881 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-(3-ethoxypropyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCOCCCNC(=O)CN1C(=O)N[C@](C)(c2cccc3ccccc23)C1=O |
| InChI | InChI=1S/C21H25N3O4/c1-3-28-13-7-12-22-18(25)14-24-19(26)21(2,23-20(24)27)17-11-6-9-15-8-4-5-10-16(15)17/h4-6,8-11H,3,7,12-14H2,1-2H3,(H,22,25)(H,23,27)/t21-/m1/s1 |
| InChIKey | YYAYJNOKKSBJKG-OAQYLSRUSA-N |
| XLogP | 2.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|