C23H31ClO6 — CID 40782850
ditert-butyl (1S,2R,3S,4R)-2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 40782850) has the molecular formula C23H31ClO6 and a molecular weight of 438.95 g/mol. Its IUPAC name is ditert-butyl (1S,2R,3S,4R)-2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | ditert-butyl (1S,2R,3S,4R)-2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 40782850 |
| Molecular Formula | C23H31ClO6 |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | ditert-butyl (1S,2R,3S,4R)-2-(4-chlorophenyl)-4-hydroxy-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C(=O)C[C@@](C)(O)[C@@H](C(=O)OC(C)(C)C)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H31ClO6/c1-21(2,3)29-19(26)17-15(25)12-23(7,28)18(20(27)30-22(4,5)6)16(17)13-8-10-14(24)11-9-13/h8-11,16-18,28H,12H2,1-7H3/t16-,17+,18+,23+/m0/s1 |
| InChIKey | QGSYQWMAQIQJSC-PMECCGAFSA-N |
| XLogP | 4.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|