C22H26F3N3O4 — CID 40785642
(2S)-2-(2,4-dimethoxyanilino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 40785642) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethoxyanilino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2S)-2-(2,4-dimethoxyanilino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 40785642 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2S)-2-(2,4-dimethoxyanilino)-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | COc1ccc(N[C@@H](C)C(=O)Nc2cc(C(F)(F)F)ccc2N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C22H26F3N3O4/c1-14(26-17-6-5-16(30-2)13-20(17)31-3)21(29)27-18-12-15(22(23,24)25)4-7-19(18)28-8-10-32-11-9-28/h4-7,12-14,26H,8-11H2,1-3H3,(H,27,29)/t14-/m0/s1 |
| InChIKey | JPGMGZAZRXELLY-AWEZNQCLSA-N |
| XLogP | 4.00 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|