C27H26F2N4OS — CID 40785850
2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide (PubChem CID 40785850) has the molecular formula C27H26F2N4OS and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 40785850 |
| Molecular Formula | C27H26F2N4OS |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[(3R,3aR,7E)-3-(4-fluorophenyl)-7-[(4-fluorophenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-N,N,4-trimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N2N=C3/C(=C/c4ccc(F)cc4)CCC[C@@H]3[C@@H]2c2ccc(F)cc2)sc1C(=O)N(C)C |
| InChI | InChI=1S/C27H26F2N4OS/c1-16-25(26(34)32(2)3)35-27(30-16)33-24(18-9-13-21(29)14-10-18)22-6-4-5-19(23(22)31-33)15-17-7-11-20(28)12-8-17/h7-15,22,24H,4-6H2,1-3H3/b19-15+/t22-,24-/m0/s1 |
| InChIKey | CZENQEBSMFTWFN-BYBLBYPZSA-N |
| XLogP | 6.23 |
| TPSA | 48.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |