C18H22N2O6S2 — CID 40785861
4-[[(3aS,6aS)-3-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid (PubChem CID 40785861) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4-[[(3aS,6aS)-3-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aS,6aS)-3-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 40785861 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 4-[[(3aS,6aS)-3-[2-(4-methoxyphenyl)ethyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
| SMILES | COc1ccc(CCN2/C(=N/C(=O)CCC(=O)O)S[C@@H]3CS(=O)(=O)C[C@@H]32)cc1 |
| InChI | InChI=1S/C18H22N2O6S2/c1-26-13-4-2-12(3-5-13)8-9-20-14-10-28(24,25)11-15(14)27-18(20)19-16(21)6-7-17(22)23/h2-5,14-15H,6-11H2,1H3,(H,22,23)/b19-18-/t14-,15+/m0/s1 |
| InChIKey | BDHNMUGIIQKEOJ-VVWDJWGFSA-N |
| XLogP | 1.20 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|