C13H12FN3O2 — CID 4078607
N-[(2-fluorophenyl)methoxy]-6,7-dihydro-2,1,3-benzoxadiazol-4-amine (PubChem CID 4078607) has the molecular formula C13H12FN3O2 and a molecular weight of 261.26 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methoxy]-6,7-dihydro-2,1,3-benzoxadiazol-4-amine.
| Compound Name | N-[(2-fluorophenyl)methoxy]-6,7-dihydro-2,1,3-benzoxadiazol-4-amine |
|---|---|
| PubChem CID | 4078607 |
| Molecular Formula | C13H12FN3O2 |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[(2-fluorophenyl)methoxy]-6,7-dihydro-2,1,3-benzoxadiazol-4-amine |
| SMILES | Fc1ccccc1CONC1=CCCc2nonc21 |
| InChI | InChI=1S/C13H12FN3O2/c14-10-5-2-1-4-9(10)8-18-15-11-6-3-7-12-13(11)17-19-16-12/h1-2,4-6,15H,3,7-8H2 |
| InChIKey | HVEMBLSDEFJOQO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|