About (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane
(2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane (PubChem CID 40786941) has the molecular formula C3HBrF6O
and a molecular weight of 246.93 g/mol. Its IUPAC name is (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane.
Molecular Properties
| Compound Name | (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane |
| PubChem CID | 40786941 |
| Molecular Formula | C3HBrF6O |
| Molecular Weight | 246.93 g/mol |
| Exact Mass | 245.91 |
| IUPAC Name | (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane |
| SMILES | F[C@H](OC(F)(F)F)C(F)(F)Br |
| InChI | InChI=1S/C3HBrF6O/c4-2(6,7)1(5)11-3(8,9)10/h1H/t1-/m1/s1 |
| InChIKey | PJLXAVKTUMSCKH-PVQJCKRUSA-N |
| XLogP | 2.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane?
The IUPAC name of (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane (CID 40786941) is (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane.
What is the SMILES notation for (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane?
The canonical SMILES for (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane is F[C@H](OC(F)(F)F)C(F)(F)Br.
What is the InChIKey of (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane?
The InChIKey is PJLXAVKTUMSCKH-PVQJCKRUSA-N. The full InChI is InChI=1S/C3HBrF6O/c4-2(6,7)1(5)11-3(8,9)10/h1H/t1-/m1/s1.
What are the key properties of (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane?
(2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane has a molecular weight of 246.93 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane is sourced from PubChem (CID 40786941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).