C10H12ClN — CID 40787223
(1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 40787223) has the molecular formula C10H12ClN and a molecular weight of 181.67 g/mol. Its IUPAC name is (1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 40787223 |
| Molecular Formula | C10H12ClN |
| Molecular Weight | 181.67 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (1R)-7-chloro-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | N[C@@H]1CCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H12ClN/c11-8-5-4-7-2-1-3-10(12)9(7)6-8/h4-6,10H,1-3,12H2/t10-/m1/s1 |
| InChIKey | JKGNIZNLBBLURY-SNVBAGLBSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.67 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |