About 4-[(1S,2S)-2-methylcyclopropyl]pyridine
4-[(1S,2S)-2-methylcyclopropyl]pyridine (PubChem CID 40787591) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is 4-[(1S,2S)-2-methylcyclopropyl]pyridine.
Molecular Properties
| Compound Name | 4-[(1S,2S)-2-methylcyclopropyl]pyridine |
| PubChem CID | 40787591 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4-[(1S,2S)-2-methylcyclopropyl]pyridine |
| SMILES | C[C@H]1C[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C9H11N/c1-7-6-9(7)8-2-4-10-5-3-8/h2-5,7,9H,6H2,1H3/t7-,9-/m0/s1 |
| InChIKey | PNZKSTJEQXQXGJ-CBAPKCEASA-N |
| XLogP | 2.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(1S,2S)-2-methylcyclopropyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2S)-2-methylcyclopropyl]pyridine?
The IUPAC name of 4-[(1S,2S)-2-methylcyclopropyl]pyridine (CID 40787591) is 4-[(1S,2S)-2-methylcyclopropyl]pyridine.
What is the SMILES notation for 4-[(1S,2S)-2-methylcyclopropyl]pyridine?
The canonical SMILES for 4-[(1S,2S)-2-methylcyclopropyl]pyridine is C[C@H]1C[C@@H]1c1ccncc1.
What is the InChIKey of 4-[(1S,2S)-2-methylcyclopropyl]pyridine?
The InChIKey is PNZKSTJEQXQXGJ-CBAPKCEASA-N. The full InChI is InChI=1S/C9H11N/c1-7-6-9(7)8-2-4-10-5-3-8/h2-5,7,9H,6H2,1H3/t7-,9-/m0/s1.
What are the key properties of 4-[(1S,2S)-2-methylcyclopropyl]pyridine?
4-[(1S,2S)-2-methylcyclopropyl]pyridine has a molecular weight of 133.19 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2S)-2-methylcyclopropyl]pyridine is sourced from PubChem (CID 40787591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).