C9H11N — CID 40787591
4-[(1S,2S)-2-methylcyclopropyl]pyridine (PubChem CID 40787591) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 4-[(1S,2S)-2-methylcyclopropyl]pyridine.
| Compound Name | 4-[(1S,2S)-2-methylcyclopropyl]pyridine |
|---|---|
| PubChem CID | 40787591 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4-[(1S,2S)-2-methylcyclopropyl]pyridine |
| SMILES | C[C@H]1C[C@@H]1c1ccncc1 |
| InChI | InChI=1S/C9H11N/c1-7-6-9(7)8-2-4-10-5-3-8/h2-5,7,9H,6H2,1H3/t7-,9-/m0/s1 |
| InChIKey | PNZKSTJEQXQXGJ-CBAPKCEASA-N |
| XLogP | 2.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |