C31H43N5O3 — CID 4078913
N-[3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 4078913) has the molecular formula C31H43N5O3 and a molecular weight of 533.72 g/mol. Its IUPAC name is N-[3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | N-[3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 4078913 |
| Molecular Formula | C31H43N5O3 |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | N-[3-hydroxy-1-oxo-1-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-yl]-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC(C=CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)NC(CO)C(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C31H43N5O3/c1-23(12-13-26-25(3)11-7-14-31(26,4)5)9-6-10-24(2)21-28(38)34-27(22-37)29(39)35-17-19-36(20-18-35)30-32-15-8-16-33-30/h6,8-10,12-13,15-16,21,27,37H,7,11,14,17-20,22H2,1-5H3,(H,34,38) |
| InChIKey | DZZJOPIJARPJTK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|