C20H19NO2 — CID 40789963
N-[(R)-1-benzofuran-2-yl(phenyl)methyl]cyclobutanecarboxamide (PubChem CID 40789963) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(R)-1-benzofuran-2-yl(phenyl)methyl]cyclobutanecarboxamide.
| Compound Name | N-[(R)-1-benzofuran-2-yl(phenyl)methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 40789963 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[(R)-1-benzofuran-2-yl(phenyl)methyl]cyclobutanecarboxamide |
| SMILES | O=C(N[C@H](c1ccccc1)c1cc2ccccc2o1)C1CCC1 |
| InChI | InChI=1S/C20H19NO2/c22-20(15-10-6-11-15)21-19(14-7-2-1-3-8-14)18-13-16-9-4-5-12-17(16)23-18/h1-5,7-9,12-13,15,19H,6,10-11H2,(H,21,22)/t19-/m1/s1 |
| InChIKey | WPGUSMRSNLPXIB-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |