C20H30N6O2 — CID 40790174
6-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethyl]-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione (PubChem CID 40790174) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 6-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethyl]-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione.
| Compound Name | 6-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethyl]-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 40790174 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 6-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethyl]-2,4,7,8-tetramethylpurino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1c(C)n2c3c(=O)n(C)c(=O)n(C)c3nc2n1CCN1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C20H30N6O2/c1-12-9-13(2)11-24(10-12)7-8-25-14(3)15(4)26-16-17(21-19(25)26)22(5)20(28)23(6)18(16)27/h12-13H,7-11H2,1-6H3/t12-,13+ |
| InChIKey | PTHJZBRTYRAKEI-BETUJISGSA-N |
| XLogP | 1.28 |
| TPSA | 69.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |