C22H28N2O5 — CID 40791547
[(2R)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 40791547) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is [(2R)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [(2R)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 40791547 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [(2R)-1-[benzyl(methyl)amino]-1-oxopropan-2-yl] (2R)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | C[C@H](C(=O)O[C@H](C)C(=O)N(C)Cc1ccccc1)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C22H28N2O5/c1-14(24-20(26)17-11-7-8-12-18(17)21(24)27)22(28)29-15(2)19(25)23(3)13-16-9-5-4-6-10-16/h4-6,9-10,14-15,17-18H,7-8,11-13H2,1-3H3/t14-,15-,17-,18+/m1/s1 |
| InChIKey | SLXSVKLIWPQNCL-AHCXZYCDSA-N |
| XLogP | 2.14 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|