C11H9F7N2O3S — CID 4079273
2,2,3,3,4,4,4-heptafluoro-N-[(4-sulfamoylphenyl)methyl]butanamide (PubChem CID 4079273) has the molecular formula C11H9F7N2O3S and a molecular weight of 382.26 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-[(4-sulfamoylphenyl)methyl]butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-[(4-sulfamoylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 4079273 |
| Molecular Formula | C11H9F7N2O3S |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-[(4-sulfamoylphenyl)methyl]butanamide |
| SMILES | NS(=O)(=O)c1ccc(CNC(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F7N2O3S/c12-9(13,10(14,15)11(16,17)18)8(21)20-5-6-1-3-7(4-2-6)24(19,22)23/h1-4H,5H2,(H,20,21)(H2,19,22,23) |
| InChIKey | VABWMMCIAMBZFP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|