C24H23FN2O3 — CID 4079283
2-[2-(4-fluorophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-5-methoxyphenol (PubChem CID 4079283) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-5-methoxyphenol.
| Compound Name | 2-[2-(4-fluorophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 4079283 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-4-(3-methoxyphenyl)-1,2,5,6-tetrahydropyrimidin-6-yl]-5-methoxyphenol |
| SMILES | COc1cccc(C2=NC(c3ccc(F)cc3)NC(c3ccc(OC)cc3O)C2)c1 |
| InChI | InChI=1S/C24H23FN2O3/c1-29-18-5-3-4-16(12-18)21-14-22(20-11-10-19(30-2)13-23(20)28)27-24(26-21)15-6-8-17(25)9-7-15/h3-13,22,24,27-28H,14H2,1-2H3 |
| InChIKey | IQKAVNYLEVOKNA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|